C12H14N4O2S — CID 61347448
7-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 61347448) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 7-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | 7-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 61347448 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 7-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | Cc1nc(SCc2cc3c(cc2N)OCCO3)n[nH]1 |
| InChI | InChI=1S/C12H14N4O2S/c1-7-14-12(16-15-7)19-6-8-4-10-11(5-9(8)13)18-3-2-17-10/h4-5H,2-3,6,13H2,1H3,(H,14,15,16) |
| InChIKey | AHCHZZGCZWCHGS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|