C11H10F3N5OS — CID 61347648
N'-hydroxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)benzenecarboximidamide (PubChem CID 61347648) has the molecular formula C11H10F3N5OS and a molecular weight of 317.30 g/mol. Its IUPAC name is N'-hydroxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 61347648 |
| Molecular Formula | C11H10F3N5OS |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N'-hydroxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)benzenecarboximidamide |
| SMILES | Cc1nc(Sc2ccc(C(F)(F)F)cc2C(N)=NO)n[nH]1 |
| InChI | InChI=1S/C11H10F3N5OS/c1-5-16-10(18-17-5)21-8-3-2-6(11(12,13)14)4-7(8)9(15)19-20/h2-4,20H,1H3,(H2,15,19)(H,16,17,18) |
| InChIKey | RDIPFYLBYFLERV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|