C12H17NO3S — CID 61347926
2-(3-methylthiophen-2-yl)-2-(oxolan-2-ylmethylamino)acetic acid (PubChem CID 61347926) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-(3-methylthiophen-2-yl)-2-(oxolan-2-ylmethylamino)acetic acid.
| Compound Name | 2-(3-methylthiophen-2-yl)-2-(oxolan-2-ylmethylamino)acetic acid |
|---|---|
| PubChem CID | 61347926 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-(3-methylthiophen-2-yl)-2-(oxolan-2-ylmethylamino)acetic acid |
| SMILES | Cc1ccsc1C(NCC1CCCO1)C(=O)O |
| InChI | InChI=1S/C12H17NO3S/c1-8-4-6-17-11(8)10(12(14)15)13-7-9-3-2-5-16-9/h4,6,9-10,13H,2-3,5,7H2,1H3,(H,14,15) |
| InChIKey | CJILDTNFUIWZGZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |