C17H28N2O2 — CID 61348218
1,1-dibutyl-3-[3-(1-hydroxyethyl)phenyl]urea (PubChem CID 61348218) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1,1-dibutyl-3-[3-(1-hydroxyethyl)phenyl]urea.
| Compound Name | 1,1-dibutyl-3-[3-(1-hydroxyethyl)phenyl]urea |
|---|---|
| PubChem CID | 61348218 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1,1-dibutyl-3-[3-(1-hydroxyethyl)phenyl]urea |
| SMILES | CCCCN(CCCC)C(=O)Nc1cccc(C(C)O)c1 |
| InChI | InChI=1S/C17H28N2O2/c1-4-6-11-19(12-7-5-2)17(21)18-16-10-8-9-15(13-16)14(3)20/h8-10,13-14,20H,4-7,11-12H2,1-3H3,(H,18,21) |
| InChIKey | DYBQBBBUZCKZNO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |