About N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide
N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide (PubChem CID 61348528) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide |
| PubChem CID | 61348528 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide |
| SMILES | Cc1cccc(C(=O)N(C)CCN)n1 |
| InChI | InChI=1S/C10H15N3O/c1-8-4-3-5-9(12-8)10(14)13(2)7-6-11/h3-5H,6-7,11H2,1-2H3 |
| InChIKey | MBQNOTBVKIXIEX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide?
The IUPAC name of N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide (CID 61348528) is N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide.
What is the SMILES notation for N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide?
The canonical SMILES for N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide is Cc1cccc(C(=O)N(C)CCN)n1.
What is the InChIKey of N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide?
The InChIKey is MBQNOTBVKIXIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-8-4-3-5-9(12-8)10(14)13(2)7-6-11/h3-5H,6-7,11H2,1-2H3.
What are the key properties of N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide?
N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide has a molecular weight of 193.25 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N,6-dimethylpyridine-2-carboxamide is sourced from PubChem (CID 61348528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).