About 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid
3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid (PubChem CID 61349431) has the molecular formula C7H11NO4
and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid |
| PubChem CID | 61349431 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid |
| SMILES | O=C(O)CCN1CCCOC1=O |
| InChI | InChI=1S/C7H11NO4/c9-6(10)2-4-8-3-1-5-12-7(8)11/h1-5H2,(H,9,10) |
| InChIKey | MPKYDYURXMRGMY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid?
The IUPAC name of 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid (CID 61349431) is 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid.
What is the SMILES notation for 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid?
The canonical SMILES for 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid is O=C(O)CCN1CCCOC1=O.
What is the InChIKey of 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid?
The InChIKey is MPKYDYURXMRGMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4/c9-6(10)2-4-8-3-1-5-12-7(8)11/h1-5H2,(H,9,10).
What are the key properties of 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid?
3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid has a molecular weight of 173.17 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxo-1,3-oxazinan-3-yl)propanoic acid is sourced from PubChem (CID 61349431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).