C23H20F3N3O2S — CID 6134953
N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxamide (PubChem CID 6134953) has the molecular formula C23H20F3N3O2S and a molecular weight of 459.49 g/mol. Its IUPAC name is N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6134953 |
| Molecular Formula | C23H20F3N3O2S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)C4CCCN4/C=C/C(=O)C(F)(F)F)cc3)sc2c1 |
| InChI | InChI=1S/C23H20F3N3O2S/c1-14-4-9-17-19(13-14)32-22(28-17)15-5-7-16(8-6-15)27-21(31)18-3-2-11-29(18)12-10-20(30)23(24,25)26/h4-10,12-13,18H,2-3,11H2,1H3,(H,27,31)/b12-10+ |
| InChIKey | LHGZAXOBUVBEMC-ZRDIBKRKSA-N |
| XLogP | 5.32 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|