C14H27N3O2 — CID 61349844
1-(4-methylpentan-2-yloxy)-3-[(1-methylpyrazol-4-yl)methylamino]propan-2-ol (PubChem CID 61349844) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 1-(4-methylpentan-2-yloxy)-3-[(1-methylpyrazol-4-yl)methylamino]propan-2-ol.
| Compound Name | 1-(4-methylpentan-2-yloxy)-3-[(1-methylpyrazol-4-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 61349844 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 1-(4-methylpentan-2-yloxy)-3-[(1-methylpyrazol-4-yl)methylamino]propan-2-ol |
| SMILES | CC(C)CC(C)OCC(O)CNCc1cnn(C)c1 |
| InChI | InChI=1S/C14H27N3O2/c1-11(2)5-12(3)19-10-14(18)8-15-6-13-7-16-17(4)9-13/h7,9,11-12,14-15,18H,5-6,8,10H2,1-4H3 |
| InChIKey | KIZTWCHQXVYRPV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |