About 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid
4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid (PubChem CID 6135) has the molecular formula C15H27N3O9P2
and a molecular weight of 455.34 g/mol. Its IUPAC name is 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid.
Molecular Properties
| Compound Name | 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid |
| PubChem CID | 6135 |
| Molecular Formula | C15H27N3O9P2 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid |
| SMILES | COc1cc(NC(C)CCCN)c2ncccc2c1.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C15H21N3O.2H3O4P/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14;2*1-5(2,3)4/h4,6,8-11,18H,3,5,7,16H2,1-2H3;2*(H3,1,2,3,4) |
| InChIKey | GJOHLWZHWQUKAU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 215.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid?
The IUPAC name of 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid (CID 6135) is 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid.
What is the SMILES notation for 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid?
The canonical SMILES for 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid is COc1cc(NC(C)CCCN)c2ncccc2c1.O=P(O)(O)O.O=P(O)(O)O.
What is the InChIKey of 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid?
The InChIKey is GJOHLWZHWQUKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O.2H3O4P/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14;2*1-5(2,3)4/h4,6,8-11,18H,3,5,7,16H2,1-2H3;2*(H3,1,2,3,4).
What are the key properties of 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid?
4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid has a molecular weight of 455.34 g/mol, XLogP of 0.93, 6 rotatable bonds, 8 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine;phosphoric acid is sourced from PubChem (CID 6135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).