About 4-(3-nitrophenyl)-1,3-thiazol-2-amine
4-(3-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 613504) has the molecular formula C9H7N3O2S
and a molecular weight of 221.24 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(3-nitrophenyl)-1,3-thiazol-2-amine |
| PubChem CID | 613504 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 4-(3-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C9H7N3O2S/c10-9-11-8(5-15-9)6-2-1-3-7(4-6)12(13)14/h1-5H,(H2,10,11) |
| InChIKey | CHBDOPARQRNCDM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-nitrophenyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-nitrophenyl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(3-nitrophenyl)-1,3-thiazol-2-amine (CID 613504) is 4-(3-nitrophenyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(3-nitrophenyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(3-nitrophenyl)-1,3-thiazol-2-amine is Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1.
What is the InChIKey of 4-(3-nitrophenyl)-1,3-thiazol-2-amine?
The InChIKey is CHBDOPARQRNCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2S/c10-9-11-8(5-15-9)6-2-1-3-7(4-6)12(13)14/h1-5H,(H2,10,11).
What are the key properties of 4-(3-nitrophenyl)-1,3-thiazol-2-amine?
4-(3-nitrophenyl)-1,3-thiazol-2-amine has a molecular weight of 221.24 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-nitrophenyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 613504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).