C14H18N2O3 — CID 61350762
4-[(4S)-4-methoxypyrrolidin-3-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 61350762) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-[(4S)-4-methoxypyrrolidin-3-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[(4S)-4-methoxypyrrolidin-3-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 61350762 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-[(4S)-4-methoxypyrrolidin-3-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CO[C@H]1CNCC1N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C14H18N2O3/c1-19-10-6-15-5-9(10)16-13(17)11-7-2-3-8(4-7)12(11)14(16)18/h2-3,7-12,15H,4-6H2,1H3/t7?,8?,9?,10-,11?,12?/m0/s1 |
| InChIKey | SFTZTVUNOCTNPB-FUQDGDSFSA-N |
| XLogP | -0.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|