About N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide
N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide (PubChem CID 61351057) has the molecular formula C6H14F2N2O2S
and a molecular weight of 216.25 g/mol. Its IUPAC name is N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide |
| PubChem CID | 61351057 |
| Molecular Formula | C6H14F2N2O2S |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide |
| SMILES | CC(C)N(CCN)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C6H14F2N2O2S/c1-5(2)10(4-3-9)13(11,12)6(7)8/h5-6H,3-4,9H2,1-2H3 |
| InChIKey | OMDQHJJFTXHEGI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide?
The IUPAC name of N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide (CID 61351057) is N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide.
What is the SMILES notation for N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide?
The canonical SMILES for N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide is CC(C)N(CCN)S(=O)(=O)C(F)F.
What is the InChIKey of N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide?
The InChIKey is OMDQHJJFTXHEGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14F2N2O2S/c1-5(2)10(4-3-9)13(11,12)6(7)8/h5-6H,3-4,9H2,1-2H3.
What are the key properties of N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide?
N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide has a molecular weight of 216.25 g/mol, XLogP of 0.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-1,1-difluoro-N-propan-2-ylmethanesulfonamide is sourced from PubChem (CID 61351057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).