C11H14N2O2 — CID 61351582
2-(2-aminocyclopropyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 61351582) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(2-aminocyclopropyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(2-aminocyclopropyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 61351582 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(2-aminocyclopropyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | NC1CC1N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C11H14N2O2/c12-8-5-9(8)13-10(14)6-3-1-2-4-7(6)11(13)15/h1-2,6-9H,3-5,12H2 |
| InChIKey | JYPZLBDARQANAE-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|