C16H17N5 — CID 61351662
3-[1-(2,5-dimethylphenyl)tetrazol-5-yl]-4-methylaniline (PubChem CID 61351662) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 3-[1-(2,5-dimethylphenyl)tetrazol-5-yl]-4-methylaniline.
| Compound Name | 3-[1-(2,5-dimethylphenyl)tetrazol-5-yl]-4-methylaniline |
|---|---|
| PubChem CID | 61351662 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 3-[1-(2,5-dimethylphenyl)tetrazol-5-yl]-4-methylaniline |
| SMILES | Cc1ccc(C)c(-n2nnnc2-c2cc(N)ccc2C)c1 |
| InChI | InChI=1S/C16H17N5/c1-10-4-5-12(3)15(8-10)21-16(18-19-20-21)14-9-13(17)7-6-11(14)2/h4-9H,17H2,1-3H3 |
| InChIKey | SZYBFZNTWPLBIE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|