C12H24BNSi — CID 613520
4,5-diethyl-1,2,2-trimethyl-3-prop-1-en-2-yl-1,2,5-azasilaborole (PubChem CID 613520) has the molecular formula C12H24BNSi and a molecular weight of 221.23 g/mol. Its IUPAC name is 4,5-diethyl-1,2,2-trimethyl-3-prop-1-en-2-yl-1,2,5-azasilaborole.
| Compound Name | 4,5-diethyl-1,2,2-trimethyl-3-prop-1-en-2-yl-1,2,5-azasilaborole |
|---|---|
| PubChem CID | 613520 |
| Molecular Formula | C12H24BNSi |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4,5-diethyl-1,2,2-trimethyl-3-prop-1-en-2-yl-1,2,5-azasilaborole |
| SMILES | C=C(C)C1=C(CC)B(CC)N(C)[Si]1(C)C |
| InChI | InChI=1S/C12H24BNSi/c1-8-11-12(10(3)4)15(6,7)14(5)13(11)9-2/h3,8-9H2,1-2,4-7H3 |
| InChIKey | HVFGQTNXIIRFMH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|