C15H20N4 — CID 61352389
3-methyl-1-(3-phenyl-1H-1,2,4-triazol-5-yl)cyclohexan-1-amine (PubChem CID 61352389) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-methyl-1-(3-phenyl-1H-1,2,4-triazol-5-yl)cyclohexan-1-amine.
| Compound Name | 3-methyl-1-(3-phenyl-1H-1,2,4-triazol-5-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 61352389 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3-methyl-1-(3-phenyl-1H-1,2,4-triazol-5-yl)cyclohexan-1-amine |
| SMILES | CC1CCCC(N)(c2nc(-c3ccccc3)n[nH]2)C1 |
| InChI | InChI=1S/C15H20N4/c1-11-6-5-9-15(16,10-11)14-17-13(18-19-14)12-7-3-2-4-8-12/h2-4,7-8,11H,5-6,9-10,16H2,1H3,(H,17,18,19) |
| InChIKey | QNYBEKJDYCHCQG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |