C11H12F3N5O2 — CID 61352694
4,5-dimethoxy-2-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]aniline (PubChem CID 61352694) has the molecular formula C11H12F3N5O2 and a molecular weight of 303.24 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]aniline.
| Compound Name | 4,5-dimethoxy-2-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 61352694 |
| Molecular Formula | C11H12F3N5O2 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4,5-dimethoxy-2-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]aniline |
| SMILES | COc1cc(N)c(-c2nnnn2CC(F)(F)F)cc1OC |
| InChI | InChI=1S/C11H12F3N5O2/c1-20-8-3-6(7(15)4-9(8)21-2)10-16-17-18-19(10)5-11(12,13)14/h3-4H,5,15H2,1-2H3 |
| InChIKey | FMSZPAJVLDBIED-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|