About 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine
5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine (PubChem CID 61353056) has the molecular formula C13H10Cl2N6
and a molecular weight of 321.17 g/mol. Its IUPAC name is 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine.
Molecular Properties
| Compound Name | 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine |
| PubChem CID | 61353056 |
| Molecular Formula | C13H10Cl2N6 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine |
| SMILES | Nc1cc(N)cc(-c2nnnn2-c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N6/c14-8-1-2-12(11(15)5-8)21-13(18-19-20-21)7-3-9(16)6-10(17)4-7/h1-6H,16-17H2 |
| InChIKey | XVOIHXLSTQAFRL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine?
The IUPAC name of 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine (CID 61353056) is 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine.
What is the SMILES notation for 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine?
The canonical SMILES for 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine is Nc1cc(N)cc(-c2nnnn2-c2ccc(Cl)cc2Cl)c1.
What is the InChIKey of 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine?
The InChIKey is XVOIHXLSTQAFRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N6/c14-8-1-2-12(11(15)5-8)21-13(18-19-20-21)7-3-9(16)6-10(17)4-7/h1-6H,16-17H2.
What are the key properties of 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine?
5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine has a molecular weight of 321.17 g/mol, XLogP of 2.80, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2,4-dichlorophenyl)tetrazol-5-yl]benzene-1,3-diamine is sourced from PubChem (CID 61353056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).