C11H13N3O2S2 — CID 61353572
2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile (PubChem CID 61353572) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile.
| Compound Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 61353572 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(N2CCCS2(=O)=O)sc2c1CCNC2 |
| InChI | InChI=1S/C11H13N3O2S2/c12-6-9-8-2-3-13-7-10(8)17-11(9)14-4-1-5-18(14,15)16/h13H,1-5,7H2 |
| InChIKey | RNRCUHIIQDVHCL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |