About 1-pentylimidazol-2-amine
1-pentylimidazol-2-amine (PubChem CID 61354351) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-pentylimidazol-2-amine.
Molecular Properties
| Compound Name | 1-pentylimidazol-2-amine |
| PubChem CID | 61354351 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1-pentylimidazol-2-amine |
| SMILES | CCCCCn1ccnc1N |
| InChI | InChI=1S/C8H15N3/c1-2-3-4-6-11-7-5-10-8(11)9/h5,7H,2-4,6H2,1H3,(H2,9,10) |
| InChIKey | BZGNBEDZZHYWHI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentylimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentylimidazol-2-amine?
The IUPAC name of 1-pentylimidazol-2-amine (CID 61354351) is 1-pentylimidazol-2-amine.
What is the SMILES notation for 1-pentylimidazol-2-amine?
The canonical SMILES for 1-pentylimidazol-2-amine is CCCCCn1ccnc1N.
What is the InChIKey of 1-pentylimidazol-2-amine?
The InChIKey is BZGNBEDZZHYWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-2-3-4-6-11-7-5-10-8(11)9/h5,7H,2-4,6H2,1H3,(H2,9,10).
What are the key properties of 1-pentylimidazol-2-amine?
1-pentylimidazol-2-amine has a molecular weight of 153.23 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentylimidazol-2-amine is sourced from PubChem (CID 61354351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).