C17H14BrNO2 — CID 61354961
1-[(3-bromophenyl)methyl]-4,6-dimethylindole-2,3-dione (PubChem CID 61354961) has the molecular formula C17H14BrNO2 and a molecular weight of 344.21 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-4,6-dimethylindole-2,3-dione.
| Compound Name | 1-[(3-bromophenyl)methyl]-4,6-dimethylindole-2,3-dione |
|---|---|
| PubChem CID | 61354961 |
| Molecular Formula | C17H14BrNO2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-4,6-dimethylindole-2,3-dione |
| SMILES | Cc1cc(C)c2c(c1)N(Cc1cccc(Br)c1)C(=O)C2=O |
| InChI | InChI=1S/C17H14BrNO2/c1-10-6-11(2)15-14(7-10)19(17(21)16(15)20)9-12-4-3-5-13(18)8-12/h3-8H,9H2,1-2H3 |
| InChIKey | URYKKCVEVPRYBT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|