C13H10BrN3O3 — CID 61355173
5-bromo-7-methyl-1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]indole-2,3-dione (PubChem CID 61355173) has the molecular formula C13H10BrN3O3 and a molecular weight of 336.15 g/mol. Its IUPAC name is 5-bromo-7-methyl-1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]indole-2,3-dione.
| Compound Name | 5-bromo-7-methyl-1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 61355173 |
| Molecular Formula | C13H10BrN3O3 |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 5-bromo-7-methyl-1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]indole-2,3-dione |
| SMILES | Cc1nc(CN2C(=O)C(=O)c3cc(Br)cc(C)c32)no1 |
| InChI | InChI=1S/C13H10BrN3O3/c1-6-3-8(14)4-9-11(6)17(13(19)12(9)18)5-10-15-7(2)20-16-10/h3-4H,5H2,1-2H3 |
| InChIKey | DTQBTOVGIAIHOV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|