About 1-heptyl-6,7-dimethylindole-2,3-dione
1-heptyl-6,7-dimethylindole-2,3-dione (PubChem CID 61355246) has the molecular formula C17H23NO2
and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-heptyl-6,7-dimethylindole-2,3-dione.
Molecular Properties
| Compound Name | 1-heptyl-6,7-dimethylindole-2,3-dione |
| PubChem CID | 61355246 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1-heptyl-6,7-dimethylindole-2,3-dione |
| SMILES | CCCCCCCN1C(=O)C(=O)c2ccc(C)c(C)c21 |
| InChI | InChI=1S/C17H23NO2/c1-4-5-6-7-8-11-18-15-13(3)12(2)9-10-14(15)16(19)17(18)20/h9-10H,4-8,11H2,1-3H3 |
| InChIKey | QYQMBUPRDDYEDJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-heptyl-6,7-dimethylindole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptyl-6,7-dimethylindole-2,3-dione?
The IUPAC name of 1-heptyl-6,7-dimethylindole-2,3-dione (CID 61355246) is 1-heptyl-6,7-dimethylindole-2,3-dione.
What is the SMILES notation for 1-heptyl-6,7-dimethylindole-2,3-dione?
The canonical SMILES for 1-heptyl-6,7-dimethylindole-2,3-dione is CCCCCCCN1C(=O)C(=O)c2ccc(C)c(C)c21.
What is the InChIKey of 1-heptyl-6,7-dimethylindole-2,3-dione?
The InChIKey is QYQMBUPRDDYEDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO2/c1-4-5-6-7-8-11-18-15-13(3)12(2)9-10-14(15)16(19)17(18)20/h9-10H,4-8,11H2,1-3H3.
What are the key properties of 1-heptyl-6,7-dimethylindole-2,3-dione?
1-heptyl-6,7-dimethylindole-2,3-dione has a molecular weight of 273.38 g/mol, XLogP of 3.80, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptyl-6,7-dimethylindole-2,3-dione is sourced from PubChem (CID 61355246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).