About 1-phenoxyphthalazine
1-phenoxyphthalazine (PubChem CID 613554) has the molecular formula C14H10N2O
and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-phenoxyphthalazine.
Molecular Properties
| Compound Name | 1-phenoxyphthalazine |
| PubChem CID | 613554 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-phenoxyphthalazine |
| SMILES | c1ccc(Oc2nncc3ccccc23)cc1 |
| InChI | InChI=1S/C14H10N2O/c1-2-7-12(8-3-1)17-14-13-9-5-4-6-11(13)10-15-16-14/h1-10H |
| InChIKey | CSHSXUZQMJVDJY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenoxyphthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxyphthalazine?
The IUPAC name of 1-phenoxyphthalazine (CID 613554) is 1-phenoxyphthalazine.
What is the SMILES notation for 1-phenoxyphthalazine?
The canonical SMILES for 1-phenoxyphthalazine is c1ccc(Oc2nncc3ccccc23)cc1.
What is the InChIKey of 1-phenoxyphthalazine?
The InChIKey is CSHSXUZQMJVDJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O/c1-2-7-12(8-3-1)17-14-13-9-5-4-6-11(13)10-15-16-14/h1-10H.
What are the key properties of 1-phenoxyphthalazine?
1-phenoxyphthalazine has a molecular weight of 222.25 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxyphthalazine is sourced from PubChem (CID 613554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).