C15H14N2O3 — CID 61356229
5,7-dimethyl-1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-2,3-dione (PubChem CID 61356229) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 5,7-dimethyl-1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-2,3-dione.
| Compound Name | 5,7-dimethyl-1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 61356229 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 5,7-dimethyl-1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-2,3-dione |
| SMILES | Cc1cc(C)c2c(c1)C(=O)C(=O)N2Cc1cc(C)no1 |
| InChI | InChI=1S/C15H14N2O3/c1-8-4-9(2)13-12(5-8)14(18)15(19)17(13)7-11-6-10(3)16-20-11/h4-6H,7H2,1-3H3 |
| InChIKey | WNQNKSNPENOKGR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|