About N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide
N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide (PubChem CID 61357191) has the molecular formula C8H16F3NO2S
and a molecular weight of 247.28 g/mol. Its IUPAC name is N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide.
Molecular Properties
| Compound Name | N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide |
| PubChem CID | 61357191 |
| Molecular Formula | C8H16F3NO2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)N(CC(C)C)CC(F)(F)F |
| InChI | InChI=1S/C8H16F3NO2S/c1-4-15(13,14)12(5-7(2)3)6-8(9,10)11/h7H,4-6H2,1-3H3 |
| InChIKey | DRZLSPFJMOJCSW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide?
The IUPAC name of N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide (CID 61357191) is N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide.
What is the SMILES notation for N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide?
The canonical SMILES for N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide is CCS(=O)(=O)N(CC(C)C)CC(F)(F)F.
What is the InChIKey of N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide?
The InChIKey is DRZLSPFJMOJCSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NO2S/c1-4-15(13,14)12(5-7(2)3)6-8(9,10)11/h7H,4-6H2,1-3H3.
What are the key properties of N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide?
N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide has a molecular weight of 247.28 g/mol, XLogP of 1.86, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide is sourced from PubChem (CID 61357191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).