C12H11F2NO2 — CID 61357345
1-butyl-4,6-difluoroindole-2,3-dione (PubChem CID 61357345) has the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. Its IUPAC name is 1-butyl-4,6-difluoroindole-2,3-dione.
| Compound Name | 1-butyl-4,6-difluoroindole-2,3-dione |
|---|---|
| PubChem CID | 61357345 |
| Molecular Formula | C12H11F2NO2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 1-butyl-4,6-difluoroindole-2,3-dione |
| SMILES | CCCCN1C(=O)C(=O)c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C12H11F2NO2/c1-2-3-4-15-9-6-7(13)5-8(14)10(9)11(16)12(15)17/h5-6H,2-4H2,1H3 |
| InChIKey | SPXNMHVIRSIOCA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|