8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid

C13H10ClNO2 — CID 61357942

IUPAC8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid
SMILESO=C(O)c1c2c(nc3cccc(Cl)c13)CCC2
InChIInChI=1S/C13H10ClNO2/c14-8-4-2-6-10-12(8)11(13(16)17)7-3-1-5-9(7)15-10/h2,4,6H,1,3,5H2,(H,16,17)
InChIKeyHTCNAITXQCNEGH-UHFFFAOYSA-N
MW247.68 g/mol
LogP3.08
Rot. Bonds1

About 8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid

8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid (PubChem CID 61357942) has the molecular formula C13H10ClNO2 and a molecular weight of 247.68 g/mol. Its IUPAC name is 8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid.

Molecular Properties

Compound Name8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid
PubChem CID61357942
Molecular FormulaC13H10ClNO2
Molecular Weight247.68 g/mol
Exact Mass247.04
IUPAC Name8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid
SMILESO=C(O)c1c2c(nc3cccc(Cl)c13)CCC2
InChIInChI=1S/C13H10ClNO2/c14-8-4-2-6-10-12(8)11(13(16)17)7-3-1-5-9(7)15-10/h2,4,6H,1,3,5H2,(H,16,17)
InChIKeyHTCNAITXQCNEGH-UHFFFAOYSA-N
XLogP3.08
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.68
LogP ≤ 53.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid?
The IUPAC name of 8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid (CID 61357942) is 8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid.
What is the SMILES notation for 8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid?
The canonical SMILES for 8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid is O=C(O)c1c2c(nc3cccc(Cl)c13)CCC2.
What is the InChIKey of 8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid?
The InChIKey is HTCNAITXQCNEGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNO2/c14-8-4-2-6-10-12(8)11(13(16)17)7-3-1-5-9(7)15-10/h2,4,6H,1,3,5H2,(H,16,17).
What are the key properties of 8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid?
8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid has a molecular weight of 247.68 g/mol, XLogP of 3.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid is sourced from PubChem (CID 61357942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).