About N-amino-N'-ethylpentanimidamide
N-amino-N'-ethylpentanimidamide (PubChem CID 61360454) has the molecular formula C7H17N3
and a molecular weight of 143.23 g/mol. Its IUPAC name is N-amino-N'-ethylpentanimidamide.
Molecular Properties
| Compound Name | N-amino-N'-ethylpentanimidamide |
| PubChem CID | 61360454 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | N-amino-N'-ethylpentanimidamide |
| SMILES | CCCC/C(=N\CC)NN |
| InChI | InChI=1S/C7H17N3/c1-3-5-6-7(10-8)9-4-2/h3-6,8H2,1-2H3,(H,9,10) |
| InChIKey | UMBLTMDRBSCXBW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-ethylpentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-ethylpentanimidamide?
The IUPAC name of N-amino-N'-ethylpentanimidamide (CID 61360454) is N-amino-N'-ethylpentanimidamide.
What is the SMILES notation for N-amino-N'-ethylpentanimidamide?
The canonical SMILES for N-amino-N'-ethylpentanimidamide is CCCC/C(=N\CC)NN.
What is the InChIKey of N-amino-N'-ethylpentanimidamide?
The InChIKey is UMBLTMDRBSCXBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3/c1-3-5-6-7(10-8)9-4-2/h3-6,8H2,1-2H3,(H,9,10).
What are the key properties of N-amino-N'-ethylpentanimidamide?
N-amino-N'-ethylpentanimidamide has a molecular weight of 143.23 g/mol, XLogP of 1.06, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-ethylpentanimidamide is sourced from PubChem (CID 61360454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).