About N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide
N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide (PubChem CID 61360500) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide.
Molecular Properties
| Compound Name | N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide |
| PubChem CID | 61360500 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide |
| SMILES | CC(C)(C)/N=C(/NN)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C13H19N3O/c1-13(2,3)15-12(16-14)11-8-9-6-4-5-7-10(9)17-11/h4-7,11H,8,14H2,1-3H3,(H,15,16) |
| InChIKey | WEJCSKPGQHNJFB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide?
The IUPAC name of N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide (CID 61360500) is N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide.
What is the SMILES notation for N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide?
The canonical SMILES for N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide is CC(C)(C)/N=C(/NN)C1Cc2ccccc2O1.
What is the InChIKey of N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide?
The InChIKey is WEJCSKPGQHNJFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O/c1-13(2,3)15-12(16-14)11-8-9-6-4-5-7-10(9)17-11/h4-7,11H,8,14H2,1-3H3,(H,15,16).
What are the key properties of N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide?
N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide has a molecular weight of 233.31 g/mol, XLogP of 1.65, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-tert-butyl-2,3-dihydro-1-benzofuran-2-carboximidamide is sourced from PubChem (CID 61360500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).