About 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one
5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one (PubChem CID 61360637) has the molecular formula C9H8FNO2
and a molecular weight of 181.17 g/mol. Its IUPAC name is 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one |
| PubChem CID | 61360637 |
| Molecular Formula | C9H8FNO2 |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(F)cc2c1NC(=O)C2O |
| InChI | InChI=1S/C9H8FNO2/c1-4-2-5(10)3-6-7(4)11-9(13)8(6)12/h2-3,8,12H,1H3,(H,11,13) |
| InChIKey | LCZDPLSIMHJIBZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one?
The IUPAC name of 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one (CID 61360637) is 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one?
The canonical SMILES for 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one is Cc1cc(F)cc2c1NC(=O)C2O.
What is the InChIKey of 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one?
The InChIKey is LCZDPLSIMHJIBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO2/c1-4-2-5(10)3-6-7(4)11-9(13)8(6)12/h2-3,8,12H,1H3,(H,11,13).
What are the key properties of 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one?
5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one has a molecular weight of 181.17 g/mol, XLogP of 1.12, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-hydroxy-7-methyl-1,3-dihydroindol-2-one is sourced from PubChem (CID 61360637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).