About 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol
2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol (PubChem CID 61360816) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol.
Molecular Properties
| Compound Name | 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol |
| PubChem CID | 61360816 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol |
| SMILES | OCCNc1ccc(-c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C10H12N4O/c15-6-5-11-9-3-1-8(2-4-9)10-12-7-13-14-10/h1-4,7,11,15H,5-6H2,(H,12,13,14) |
| InChIKey | NGOVVSALXRIAQK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol?
The IUPAC name of 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol (CID 61360816) is 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol.
What is the SMILES notation for 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol?
The canonical SMILES for 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol is OCCNc1ccc(-c2ncn[nH]2)cc1.
What is the InChIKey of 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol?
The InChIKey is NGOVVSALXRIAQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c15-6-5-11-9-3-1-8(2-4-9)10-12-7-13-14-10/h1-4,7,11,15H,5-6H2,(H,12,13,14).
What are the key properties of 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol?
2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol has a molecular weight of 204.23 g/mol, XLogP of 0.88, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1H-1,2,4-triazol-5-yl)anilino]ethanol is sourced from PubChem (CID 61360816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).