About 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine
3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine (PubChem CID 61361012) has the molecular formula C6H12N4O2S
and a molecular weight of 204.25 g/mol. Its IUPAC name is 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine |
| PubChem CID | 61361012 |
| Molecular Formula | C6H12N4O2S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine |
| SMILES | CS(=O)(=O)CCC(N)c1ncn[nH]1 |
| InChI | InChI=1S/C6H12N4O2S/c1-13(11,12)3-2-5(7)6-8-4-9-10-6/h4-5H,2-3,7H2,1H3,(H,8,9,10) |
| InChIKey | WGPZTKUGFFWYRZ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine?
The IUPAC name of 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine (CID 61361012) is 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine.
What is the SMILES notation for 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine?
The canonical SMILES for 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine is CS(=O)(=O)CCC(N)c1ncn[nH]1.
What is the InChIKey of 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine?
The InChIKey is WGPZTKUGFFWYRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O2S/c1-13(11,12)3-2-5(7)6-8-4-9-10-6/h4-5H,2-3,7H2,1H3,(H,8,9,10).
What are the key properties of 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine?
3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine has a molecular weight of 204.25 g/mol, XLogP of -0.76, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfonyl-1-(1H-1,2,4-triazol-5-yl)propan-1-amine is sourced from PubChem (CID 61361012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).