About N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide
N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide (PubChem CID 61361025) has the molecular formula C11H25NO2S
and a molecular weight of 235.39 g/mol. Its IUPAC name is N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide |
| PubChem CID | 61361025 |
| Molecular Formula | C11H25NO2S |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C11H25NO2S/c1-9(2)15(13,14)12-11(6,7)8-10(3,4)5/h9,12H,8H2,1-7H3 |
| InChIKey | PXPZKLKPNKWBAN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide?
The IUPAC name of N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide (CID 61361025) is N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide.
What is the SMILES notation for N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide?
The canonical SMILES for N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide is CC(C)S(=O)(=O)NC(C)(C)CC(C)(C)C.
What is the InChIKey of N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide?
The InChIKey is PXPZKLKPNKWBAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO2S/c1-9(2)15(13,14)12-11(6,7)8-10(3,4)5/h9,12H,8H2,1-7H3.
What are the key properties of N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide?
N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide has a molecular weight of 235.39 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4,4-trimethylpentan-2-yl)propane-2-sulfonamide is sourced from PubChem (CID 61361025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).