About N-amino-N'-methylthiophene-3-carboximidamide
N-amino-N'-methylthiophene-3-carboximidamide (PubChem CID 61361049) has the molecular formula C6H9N3S
and a molecular weight of 155.23 g/mol. Its IUPAC name is N-amino-N'-methylthiophene-3-carboximidamide.
Molecular Properties
| Compound Name | N-amino-N'-methylthiophene-3-carboximidamide |
| PubChem CID | 61361049 |
| Molecular Formula | C6H9N3S |
| Molecular Weight | 155.23 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | N-amino-N'-methylthiophene-3-carboximidamide |
| SMILES | C/N=C(\NN)c1ccsc1 |
| InChI | InChI=1S/C6H9N3S/c1-8-6(9-7)5-2-3-10-4-5/h2-4H,7H2,1H3,(H,8,9) |
| InChIKey | NUHLMGJBXQLSPW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-methylthiophene-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-methylthiophene-3-carboximidamide?
The IUPAC name of N-amino-N'-methylthiophene-3-carboximidamide (CID 61361049) is N-amino-N'-methylthiophene-3-carboximidamide.
What is the SMILES notation for N-amino-N'-methylthiophene-3-carboximidamide?
The canonical SMILES for N-amino-N'-methylthiophene-3-carboximidamide is C/N=C(\NN)c1ccsc1.
What is the InChIKey of N-amino-N'-methylthiophene-3-carboximidamide?
The InChIKey is NUHLMGJBXQLSPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3S/c1-8-6(9-7)5-2-3-10-4-5/h2-4H,7H2,1H3,(H,8,9).
What are the key properties of N-amino-N'-methylthiophene-3-carboximidamide?
N-amino-N'-methylthiophene-3-carboximidamide has a molecular weight of 155.23 g/mol, XLogP of 0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-methylthiophene-3-carboximidamide is sourced from PubChem (CID 61361049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).