6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid

C9H11N3O2 — CID 61361226

IUPAC6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid
SMILESO=C(O)C1CC=CCC1c1ncn[nH]1
InChIInChI=1S/C9H11N3O2/c13-9(14)7-4-2-1-3-6(7)8-10-5-11-12-8/h1-2,5-7H,3-4H2,(H,13,14)(H,10,11,12)
InChIKeyFPQPIIJTELWILI-UHFFFAOYSA-N
MW193.21 g/mol
LogP0.94
Rot. Bonds2

About 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid

6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 61361226) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid.

Molecular Properties

Compound Name6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid
PubChem CID61361226
Molecular FormulaC9H11N3O2
Molecular Weight193.21 g/mol
Exact Mass193.09
IUPAC Name6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid
SMILESO=C(O)C1CC=CCC1c1ncn[nH]1
InChIInChI=1S/C9H11N3O2/c13-9(14)7-4-2-1-3-6(7)8-10-5-11-12-8/h1-2,5-7H,3-4H2,(H,13,14)(H,10,11,12)
InChIKeyFPQPIIJTELWILI-UHFFFAOYSA-N
XLogP0.94
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.21
LogP ≤ 50.94
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid?
The IUPAC name of 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid (CID 61361226) is 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid.
What is the SMILES notation for 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid?
The canonical SMILES for 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid is O=C(O)C1CC=CCC1c1ncn[nH]1.
What is the InChIKey of 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid?
The InChIKey is FPQPIIJTELWILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c13-9(14)7-4-2-1-3-6(7)8-10-5-11-12-8/h1-2,5-7H,3-4H2,(H,13,14)(H,10,11,12).
What are the key properties of 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid?
6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid has a molecular weight of 193.21 g/mol, XLogP of 0.94, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid is sourced from PubChem (CID 61361226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).