About 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid
6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 61361226) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid |
| PubChem CID | 61361226 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1c1ncn[nH]1 |
| InChI | InChI=1S/C9H11N3O2/c13-9(14)7-4-2-1-3-6(7)8-10-5-11-12-8/h1-2,5-7H,3-4H2,(H,13,14)(H,10,11,12) |
| InChIKey | FPQPIIJTELWILI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid?
The IUPAC name of 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid (CID 61361226) is 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid.
What is the SMILES notation for 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid?
The canonical SMILES for 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid is O=C(O)C1CC=CCC1c1ncn[nH]1.
What is the InChIKey of 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid?
The InChIKey is FPQPIIJTELWILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c13-9(14)7-4-2-1-3-6(7)8-10-5-11-12-8/h1-2,5-7H,3-4H2,(H,13,14)(H,10,11,12).
What are the key properties of 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid?
6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid has a molecular weight of 193.21 g/mol, XLogP of 0.94, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid is sourced from PubChem (CID 61361226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).