About 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one
4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 61361227) has the molecular formula C8H5F2NO2
and a molecular weight of 185.13 g/mol. Its IUPAC name is 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one |
| PubChem CID | 61361227 |
| Molecular Formula | C8H5F2NO2 |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(F)cc(F)c2C1O |
| InChI | InChI=1S/C8H5F2NO2/c9-3-1-4(10)6-5(2-3)11-8(13)7(6)12/h1-2,7,12H,(H,11,13) |
| InChIKey | WPSXBOGKXBYZIU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one?
The IUPAC name of 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one (CID 61361227) is 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one.
What is the SMILES notation for 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one?
The canonical SMILES for 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one is O=C1Nc2cc(F)cc(F)c2C1O.
What is the InChIKey of 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one?
The InChIKey is WPSXBOGKXBYZIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F2NO2/c9-3-1-4(10)6-5(2-3)11-8(13)7(6)12/h1-2,7,12H,(H,11,13).
What are the key properties of 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one?
4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one has a molecular weight of 185.13 g/mol, XLogP of 0.95, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-difluoro-3-hydroxy-1,3-dihydroindol-2-one is sourced from PubChem (CID 61361227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).