About N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide
N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide (PubChem CID 61361306) has the molecular formula C10H23N3
and a molecular weight of 185.31 g/mol. Its IUPAC name is N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide.
Molecular Properties
| Compound Name | N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide |
| PubChem CID | 61361306 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide |
| SMILES | CC(C)(C)C/C(=N\C(C)(C)C)NN |
| InChI | InChI=1S/C10H23N3/c1-9(2,3)7-8(13-11)12-10(4,5)6/h7,11H2,1-6H3,(H,12,13) |
| InChIKey | PAFJLWXAPIETNQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide?
The IUPAC name of N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide (CID 61361306) is N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide.
What is the SMILES notation for N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide?
The canonical SMILES for N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide is CC(C)(C)C/C(=N\C(C)(C)C)NN.
What is the InChIKey of N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide?
The InChIKey is PAFJLWXAPIETNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3/c1-9(2,3)7-8(13-11)12-10(4,5)6/h7,11H2,1-6H3,(H,12,13).
What are the key properties of N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide?
N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide has a molecular weight of 185.31 g/mol, XLogP of 2.08, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-tert-butyl-3,3-dimethylbutanimidamide is sourced from PubChem (CID 61361306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).