About N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide
N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide (PubChem CID 61361536) has the molecular formula C16H25N3
and a molecular weight of 259.40 g/mol. Its IUPAC name is N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide.
Molecular Properties
| Compound Name | N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide |
| PubChem CID | 61361536 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide |
| SMILES | CC(C)c1ccc(/C(=N/C2CCCCC2)NN)cc1 |
| InChI | InChI=1S/C16H25N3/c1-12(2)13-8-10-14(11-9-13)16(19-17)18-15-6-4-3-5-7-15/h8-12,15H,3-7,17H2,1-2H3,(H,18,19) |
| InChIKey | MXISCWDKNNKIPM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide?
The IUPAC name of N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide (CID 61361536) is N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide.
What is the SMILES notation for N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide?
The canonical SMILES for N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide is CC(C)c1ccc(/C(=N/C2CCCCC2)NN)cc1.
What is the InChIKey of N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide?
The InChIKey is MXISCWDKNNKIPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3/c1-12(2)13-8-10-14(11-9-13)16(19-17)18-15-6-4-3-5-7-15/h8-12,15H,3-7,17H2,1-2H3,(H,18,19).
What are the key properties of N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide?
N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide has a molecular weight of 259.40 g/mol, XLogP of 3.35, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-cyclohexyl-4-propan-2-ylbenzenecarboximidamide is sourced from PubChem (CID 61361536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).