About 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline
5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline (PubChem CID 61361577) has the molecular formula C15H19BrN4
and a molecular weight of 335.25 g/mol. Its IUPAC name is 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline.
Molecular Properties
| Compound Name | 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline |
| PubChem CID | 61361577 |
| Molecular Formula | C15H19BrN4 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline |
| SMILES | Cc1nnc(-c2ccc(Br)cc2N)n1C1CCCCC1 |
| InChI | InChI=1S/C15H19BrN4/c1-10-18-19-15(13-8-7-11(16)9-14(13)17)20(10)12-5-3-2-4-6-12/h7-9,12H,2-6,17H2,1H3 |
| InChIKey | FIVMNTGOYIAVGE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline?
The IUPAC name of 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline (CID 61361577) is 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline.
What is the SMILES notation for 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline?
The canonical SMILES for 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline is Cc1nnc(-c2ccc(Br)cc2N)n1C1CCCCC1.
What is the InChIKey of 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline?
The InChIKey is FIVMNTGOYIAVGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrN4/c1-10-18-19-15(13-8-7-11(16)9-14(13)17)20(10)12-5-3-2-4-6-12/h7-9,12H,2-6,17H2,1H3.
What are the key properties of 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline?
5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline has a molecular weight of 335.25 g/mol, XLogP of 4.10, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(4-cyclohexyl-5-methyl-1,2,4-triazol-3-yl)aniline is sourced from PubChem (CID 61361577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).