About 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one
4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 61361632) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one |
| PubChem CID | 61361632 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | CCOc1ccc(OCC)c2c1NC(=O)C2O |
| InChI | InChI=1S/C12H15NO4/c1-3-16-7-5-6-8(17-4-2)10-9(7)11(14)12(15)13-10/h5-6,11,14H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | YQYHDCNLBJZGMV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one?
The IUPAC name of 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one (CID 61361632) is 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one.
What is the SMILES notation for 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one?
The canonical SMILES for 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one is CCOc1ccc(OCC)c2c1NC(=O)C2O.
What is the InChIKey of 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one?
The InChIKey is YQYHDCNLBJZGMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-3-16-7-5-6-8(17-4-2)10-9(7)11(14)12(15)13-10/h5-6,11,14H,3-4H2,1-2H3,(H,13,15).
What are the key properties of 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one?
4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one has a molecular weight of 237.25 g/mol, XLogP of 1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-diethoxy-3-hydroxy-1,3-dihydroindol-2-one is sourced from PubChem (CID 61361632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).