C12H15N5 — CID 61363136
N-amino-1,5-dimethyl-N'-phenylpyrazole-4-carboximidamide (PubChem CID 61363136) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is N-amino-1,5-dimethyl-N'-phenylpyrazole-4-carboximidamide.
| Compound Name | N-amino-1,5-dimethyl-N'-phenylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 61363136 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-amino-1,5-dimethyl-N'-phenylpyrazole-4-carboximidamide |
| SMILES | Cc1c(/C(=N/c2ccccc2)NN)cnn1C |
| InChI | InChI=1S/C12H15N5/c1-9-11(8-14-17(9)2)12(16-13)15-10-6-4-3-5-7-10/h3-8H,13H2,1-2H3,(H,15,16) |
| InChIKey | XSOYEELSQKWYHL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|