About N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide
N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide (PubChem CID 61363318) has the molecular formula C15H17N3
and a molecular weight of 239.32 g/mol. Its IUPAC name is N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide.
Molecular Properties
| Compound Name | N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide |
| PubChem CID | 61363318 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide |
| SMILES | Cc1ccccc1C/C(=N/c1ccccc1)NN |
| InChI | InChI=1S/C15H17N3/c1-12-7-5-6-8-13(12)11-15(18-16)17-14-9-3-2-4-10-14/h2-10H,11,16H2,1H3,(H,17,18) |
| InChIKey | IFCGSDOMXQAZTH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide?
The IUPAC name of N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide (CID 61363318) is N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide.
What is the SMILES notation for N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide?
The canonical SMILES for N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide is Cc1ccccc1C/C(=N/c1ccccc1)NN.
What is the InChIKey of N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide?
The InChIKey is IFCGSDOMXQAZTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3/c1-12-7-5-6-8-13(12)11-15(18-16)17-14-9-3-2-4-10-14/h2-10H,11,16H2,1H3,(H,17,18).
What are the key properties of N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide?
N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide has a molecular weight of 239.32 g/mol, XLogP of 2.73, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-2-(2-methylphenyl)-N'-phenylethanimidamide is sourced from PubChem (CID 61363318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).