C22H15BrN2O3S2 — CID 6136431
N-[(5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetamide (PubChem CID 6136431) has the molecular formula C22H15BrN2O3S2 and a molecular weight of 499.41 g/mol. Its IUPAC name is N-[(5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetamide.
| Compound Name | N-[(5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 6136431 |
| Molecular Formula | C22H15BrN2O3S2 |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | N-[(5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NN1C(=O)/C(=C\c2ccc(-c3ccc(Br)cc3)o2)SC1=S |
| InChI | InChI=1S/C22H15BrN2O3S2/c23-16-8-6-15(7-9-16)18-11-10-17(28-18)13-19-21(27)25(22(29)30-19)24-20(26)12-14-4-2-1-3-5-14/h1-11,13H,12H2,(H,24,26)/b19-13+ |
| InChIKey | BLKPKFXZLYOFJM-CPNJWEJPSA-N |
| XLogP | 5.18 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|