C14H28N2O — CID 61364601
2-[(1-methylcyclopentyl)amino]-N-pentan-3-ylpropanamide (PubChem CID 61364601) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-[(1-methylcyclopentyl)amino]-N-pentan-3-ylpropanamide.
| Compound Name | 2-[(1-methylcyclopentyl)amino]-N-pentan-3-ylpropanamide |
|---|---|
| PubChem CID | 61364601 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 2-[(1-methylcyclopentyl)amino]-N-pentan-3-ylpropanamide |
| SMILES | CCC(CC)NC(=O)C(C)NC1(C)CCCC1 |
| InChI | InChI=1S/C14H28N2O/c1-5-12(6-2)15-13(17)11(3)16-14(4)9-7-8-10-14/h11-12,16H,5-10H2,1-4H3,(H,15,17) |
| InChIKey | OOMTZBUDMBVQNR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |