C13H18N4O2 — CID 61364636
N-[3-(carbamoylamino)phenyl]-2-pyrrolidin-2-ylacetamide (PubChem CID 61364636) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-[3-(carbamoylamino)phenyl]-2-pyrrolidin-2-ylacetamide.
| Compound Name | N-[3-(carbamoylamino)phenyl]-2-pyrrolidin-2-ylacetamide |
|---|---|
| PubChem CID | 61364636 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-[3-(carbamoylamino)phenyl]-2-pyrrolidin-2-ylacetamide |
| SMILES | NC(=O)Nc1cccc(NC(=O)CC2CCCN2)c1 |
| InChI | InChI=1S/C13H18N4O2/c14-13(19)17-11-4-1-3-10(7-11)16-12(18)8-9-5-2-6-15-9/h1,3-4,7,9,15H,2,5-6,8H2,(H,16,18)(H3,14,17,19) |
| InChIKey | FXEWUYOGIUVMPT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |