About 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole
2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole (PubChem CID 61365501) has the molecular formula C15H16N2O3
and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole |
| PubChem CID | 61365501 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole |
| SMILES | COc1cc2nc(-c3cc(C)oc3C)[nH]c2cc1OC |
| InChI | InChI=1S/C15H16N2O3/c1-8-5-10(9(2)20-8)15-16-11-6-13(18-3)14(19-4)7-12(11)17-15/h5-7H,1-4H3,(H,16,17) |
| InChIKey | SWDIDPUBTBQJSZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole?
The IUPAC name of 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole (CID 61365501) is 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole.
What is the SMILES notation for 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole?
The canonical SMILES for 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole is COc1cc2nc(-c3cc(C)oc3C)[nH]c2cc1OC.
What is the InChIKey of 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole?
The InChIKey is SWDIDPUBTBQJSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O3/c1-8-5-10(9(2)20-8)15-16-11-6-13(18-3)14(19-4)7-12(11)17-15/h5-7H,1-4H3,(H,16,17).
What are the key properties of 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole?
2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole has a molecular weight of 272.30 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylfuran-3-yl)-5,6-dimethoxy-1H-benzimidazole is sourced from PubChem (CID 61365501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).