C16H22FN — CID 61365737
1-(2-bicyclo[2.2.1]heptanyl)-2-(2-fluorophenyl)-N-methylethanamine (PubChem CID 61365737) has the molecular formula C16H22FN and a molecular weight of 247.36 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-2-(2-fluorophenyl)-N-methylethanamine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-(2-fluorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 61365737 |
| Molecular Formula | C16H22FN |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-(2-fluorophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccccc1F)C1CC2CCC1C2 |
| InChI | InChI=1S/C16H22FN/c1-18-16(10-13-4-2-3-5-15(13)17)14-9-11-6-7-12(14)8-11/h2-5,11-12,14,16,18H,6-10H2,1H3 |
| InChIKey | OQOFELDNQQTGAC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |