C15H16BNO — CID 613678
4-methyl-2,5-diphenyl-1,3,2-oxazaborolidine (PubChem CID 613678) has the molecular formula C15H16BNO and a molecular weight of 237.11 g/mol. Its IUPAC name is 4-methyl-2,5-diphenyl-1,3,2-oxazaborolidine.
| Compound Name | 4-methyl-2,5-diphenyl-1,3,2-oxazaborolidine |
|---|---|
| PubChem CID | 613678 |
| Molecular Formula | C15H16BNO |
| Molecular Weight | 237.11 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 4-methyl-2,5-diphenyl-1,3,2-oxazaborolidine |
| SMILES | CC1NB(c2ccccc2)OC1c1ccccc1 |
| InChI | InChI=1S/C15H16BNO/c1-12-15(13-8-4-2-5-9-13)18-16(17-12)14-10-6-3-7-11-14/h2-12,15,17H,1H3 |
| InChIKey | HHJCYJBOQILYAU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.11 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|