C7H8F2N2OS — CID 61367922
2-(2,2-difluoroethylsulfinyl)pyridin-3-amine (PubChem CID 61367922) has the molecular formula C7H8F2N2OS and a molecular weight of 206.22 g/mol. Its IUPAC name is 2-(2,2-difluoroethylsulfinyl)pyridin-3-amine.
| Compound Name | 2-(2,2-difluoroethylsulfinyl)pyridin-3-amine |
|---|---|
| PubChem CID | 61367922 |
| Molecular Formula | C7H8F2N2OS |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 2-(2,2-difluoroethylsulfinyl)pyridin-3-amine |
| SMILES | Nc1cccnc1S(=O)CC(F)F |
| InChI | InChI=1S/C7H8F2N2OS/c8-6(9)4-13(12)7-5(10)2-1-3-11-7/h1-3,6H,4,10H2 |
| InChIKey | HJWKANPASXXSDF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |